Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Aluminum oxide, 5016-A, Basic, Brockmann Grade I
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Sodium Hexametaphosphate, Thermo Scientific Chemicals
CAS: 68915-31-1 Molecular Formula: H2Na2O7P2 Molecular Weight (g/mol): 221.94 MDL Number: MFCD00136045 InChI Key: GYQBBRRVRKFJRG-UHFFFAOYSA-L IUPAC Name: disodium hydrogen (hydrogen phosphonatooxy)phosphonate SMILES: [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O
| CAS | 68915-31-1 |
|---|---|
| Molecular Weight (g/mol) | 221.94 |
| MDL Number | MFCD00136045 |
| SMILES | [Na+].[Na+].OP([O-])(=O)OP(O)([O-])=O |
| IUPAC Name | disodium hydrogen (hydrogen phosphonatooxy)phosphonate |
| InChI Key | GYQBBRRVRKFJRG-UHFFFAOYSA-L |
| Molecular Formula | H2Na2O7P2 |
Manganese Chloride, Tetrahydrate, MP Biomedicals
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Lithium hydroxide, anhydrous, 98%
CAS: 1310-65-2 Molecular Formula: HLiO Molecular Weight (g/mol): 23.95 MDL Number: MFCD00011095 InChI Key: WMFOQBRAJBCJND-UHFFFAOYSA-M Synonym: lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous PubChem CID: 3939 ChEBI: CHEBI:33979 SMILES: [Li+].[OH-]
| PubChem CID | 3939 |
|---|---|
| CAS | 1310-65-2 |
| Molecular Weight (g/mol) | 23.95 |
| ChEBI | CHEBI:33979 |
| MDL Number | MFCD00011095 |
| SMILES | [Li+].[OH-] |
| Synonym | lithium hydroxide,lithium hydrate,lioh,lithium hydroxide anhydrous,lithium hydroxide li oh,lithiumhydroxid,lithiumhydroxide,lithium hydoxide,unii-903yl31jas,lithium hydroxide, anhydrous |
| InChI Key | WMFOQBRAJBCJND-UHFFFAOYSA-M |
| Molecular Formula | HLiO |
Silicone oil, for melting point and boiling point apparatuses
CAS: 63148-62-9 Molecular Formula: (C2H6OSi)n Molecular Weight (g/mol): NaN MDL Number: MFCD00132673 Synonym: Poly(dimethylsiloxane) IUPAC Name: Polydimethylsiloxane SMILES: C[Si](C)(-*)O-*
| CAS | 63148-62-9 |
|---|---|
| Molecular Weight (g/mol) | NaN |
| MDL Number | MFCD00132673 |
| SMILES | C[Si](C)(-*)O-* |
| Synonym | Poly(dimethylsiloxane) |
| IUPAC Name | Polydimethylsiloxane |
| Molecular Formula | (C2H6OSi)n |
Tin(II) chloride dihydrate, low in Mercury, suitable for AAS
CAS: 10025-69-1 Molecular Formula: Cl2Sn·2H2O Molecular Weight (g/mol): 225.63 Synonym: Stannous chloride dihydrate
| CAS | 10025-69-1 |
|---|---|
| Molecular Weight (g/mol) | 225.63 |
| Synonym | Stannous chloride dihydrate |
| Molecular Formula | Cl2Sn·2H2O |
Ammonium nitrate, ACS, 95% min, Thermo Scientific Chemicals
CAS: 6484-52-2 Molecular Formula: H4N2O3 Molecular Weight (g/mol): 80.04 MDL Number: MFCD00011425 InChI Key: DVARTQFDIMZBAA-UHFFFAOYSA-O Synonym: ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills PubChem CID: 22985 ChEBI: CHEBI:63038 IUPAC Name: ammonium nitrate SMILES: [NH4+].[O-][N+]([O-])=O
| PubChem CID | 22985 |
|---|---|
| CAS | 6484-52-2 |
| Molecular Weight (g/mol) | 80.04 |
| ChEBI | CHEBI:63038 |
| MDL Number | MFCD00011425 |
| SMILES | [NH4+].[O-][N+]([O-])=O |
| Synonym | ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills |
| IUPAC Name | ammonium nitrate |
| InChI Key | DVARTQFDIMZBAA-UHFFFAOYSA-O |
| Molecular Formula | H4N2O3 |
Potassium ferrocyanide trihydrate, 99+%, for analysis
CAS: 14459-95-1 Molecular Formula: C6H6FeK4N6O3 Molecular Weight (g/mol): 422.39 MDL Number: MFCD00167023 InChI Key: NLYKFUFIUWPPIZ-UHFFFAOYSA-N Synonym: Potassium hexacyanoferrate(II) IUPAC Name: tetrapotassium hexacyanoironbis(ylium) trihydrate SMILES: O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N
| CAS | 14459-95-1 |
|---|---|
| Molecular Weight (g/mol) | 422.39 |
| MDL Number | MFCD00167023 |
| SMILES | O.O.O.[K+].[K+].[K+].[K+].N#C[Fe++](C#N)(C#N)(C#N)(C#N)C#N |
| Synonym | Potassium hexacyanoferrate(II) |
| IUPAC Name | tetrapotassium hexacyanoironbis(ylium) trihydrate |
| InChI Key | NLYKFUFIUWPPIZ-UHFFFAOYSA-N |
| Molecular Formula | C6H6FeK4N6O3 |
Ammonium dihydrogen phosphate, 99+%, for analysis
CAS: 7722-76-1 Molecular Formula: H6NO4P Molecular Weight (g/mol): 115.03 MDL Number: MFCD00003396 InChI Key: LFVGISIMTYGQHF-UHFFFAOYSA-N Synonym: ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate PubChem CID: 24402 ChEBI: CHEBI:62982 IUPAC Name: phosphoric acid amine SMILES: N.OP(O)(O)=O
| PubChem CID | 24402 |
|---|---|
| CAS | 7722-76-1 |
| Molecular Weight (g/mol) | 115.03 |
| ChEBI | CHEBI:62982 |
| MDL Number | MFCD00003396 |
| SMILES | N.OP(O)(O)=O |
| Synonym | ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate |
| IUPAC Name | phosphoric acid amine |
| InChI Key | LFVGISIMTYGQHF-UHFFFAOYSA-N |
| Molecular Formula | H6NO4P |
Potassium pyrophosphate, anhydrous, 96% min
CAS: 7320-34-5 Molecular Formula: K4O7P2 Molecular Weight (g/mol): 330.33 MDL Number: MFCD00011393 InChI Key: RYCLIXPGLDDLTM-UHFFFAOYSA-J Synonym: potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate PubChem CID: 23740 IUPAC Name: tetrapotassium;phosphonato phosphate SMILES: [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O
| PubChem CID | 23740 |
|---|---|
| CAS | 7320-34-5 |
| Molecular Weight (g/mol) | 330.33 |
| MDL Number | MFCD00011393 |
| SMILES | [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate |
| IUPAC Name | tetrapotassium;phosphonato phosphate |
| InChI Key | RYCLIXPGLDDLTM-UHFFFAOYSA-J |
| Molecular Formula | K4O7P2 |
Lead(II) nitrate, 99+%
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Cobalt(II) sulfate heptahydrate, 99+%, extra pure
CAS: 10026-24-1 Molecular Formula: CoH14O11S Molecular Weight (g/mol): 281.09 MDL Number: MFCD00149658 InChI Key: MEYVLGVRTYSQHI-UHFFFAOYSA-L Synonym: cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o PubChem CID: 61444 SMILES: O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O
| PubChem CID | 61444 |
|---|---|
| CAS | 10026-24-1 |
| Molecular Weight (g/mol) | 281.09 |
| MDL Number | MFCD00149658 |
| SMILES | O.O.O.O.O.O.O.[Co++].[O-]S([O-])(=O)=O |
| Synonym | cobalt sulfate heptahydrate,cobalt 2+ sulfate heptahydrate,cobaltous sulfate heptahydrate,cobalt ii sulfate heptahydrate,cobalt monosulfate heptahydrate,dsstox_cid_340,dsstox_rid_75523,dsstox_gsid_20340,bieberite,coo4s.7h2o |
| InChI Key | MEYVLGVRTYSQHI-UHFFFAOYSA-L |
| Molecular Formula | CoH14O11S |
Sodium bromate, 99.5% (metals basis)
CAS: 7789-38-0 Molecular Formula: BrNaO3 Molecular Weight (g/mol): 150.891 MDL Number: MFCD00003476 InChI Key: XUXNAKZDHHEHPC-UHFFFAOYSA-M Synonym: sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french PubChem CID: 23668195 ChEBI: CHEBI:75229 IUPAC Name: sodium;bromate SMILES: [O-]Br(=O)=O.[Na+]
| PubChem CID | 23668195 |
|---|---|
| CAS | 7789-38-0 |
| Molecular Weight (g/mol) | 150.891 |
| ChEBI | CHEBI:75229 |
| MDL Number | MFCD00003476 |
| SMILES | [O-]Br(=O)=O.[Na+] |
| Synonym | sodium bromate,bromic acid, sodium salt,dyetone,bromate de sodium,sodium bromate dot,neutralizer k-126,neutralizer k-140,neutralizer k-938,sodium bromate nabro3,bromate de sodium french |
| IUPAC Name | sodium;bromate |
| InChI Key | XUXNAKZDHHEHPC-UHFFFAOYSA-M |
| Molecular Formula | BrNaO3 |
Manganese(IV) oxide activated, tech. 90%
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |